4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid

C9H17NO6S2 — CID 43351325

IUPAC4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid
SMILESCN(CCCC(=O)O)S(=O)(=O)C1CCS(=O)(=O)C1
InChIInChI=1S/C9H17NO6S2/c1-10(5-2-3-9(11)12)18(15,16)8-4-6-17(13,14)7-8/h8H,2-7H2,1H3,(H,11,12)
InChIKeyADMWYYGACLYIBM-UHFFFAOYSA-N
MW299.37 g/mol
LogP-0.70
Rot. Bonds6

About 4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid

4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid (PubChem CID 43351325) has the molecular formula C9H17NO6S2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid.

Molecular Properties

Compound Name4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid
PubChem CID43351325
Molecular FormulaC9H17NO6S2
Molecular Weight299.37 g/mol
Exact Mass299.05
IUPAC Name4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid
SMILESCN(CCCC(=O)O)S(=O)(=O)C1CCS(=O)(=O)C1
InChIInChI=1S/C9H17NO6S2/c1-10(5-2-3-9(11)12)18(15,16)8-4-6-17(13,14)7-8/h8H,2-7H2,1H3,(H,11,12)
InChIKeyADMWYYGACLYIBM-UHFFFAOYSA-N
XLogP-0.70
TPSA108.82 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.37
LogP ≤ 5-0.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid?
The IUPAC name of 4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid (CID 43351325) is 4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid.
What is the SMILES notation for 4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid?
The canonical SMILES for 4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid is CN(CCCC(=O)O)S(=O)(=O)C1CCS(=O)(=O)C1.
What is the InChIKey of 4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid?
The InChIKey is ADMWYYGACLYIBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO6S2/c1-10(5-2-3-9(11)12)18(15,16)8-4-6-17(13,14)7-8/h8H,2-7H2,1H3,(H,11,12).
What are the key properties of 4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid?
4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid has a molecular weight of 299.37 g/mol, XLogP of -0.70, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,1-dioxothiolan-3-yl)sulfonyl-methylamino]butanoic acid is sourced from PubChem (CID 43351325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).