4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid

C12H11NO5S — CID 43352407

IUPAC4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid
SMILESO=C(O)c1ccc(SCC(=O)N2CCOC2=O)cc1
InChIInChI=1S/C12H11NO5S/c14-10(13-5-6-18-12(13)17)7-19-9-3-1-8(2-4-9)11(15)16/h1-4H,5-7H2,(H,15,16)
InChIKeyUKWWHNNKMIRURL-UHFFFAOYSA-N
MW281.29 g/mol
LogP1.46
Rot. Bonds4

About 4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid

4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid (PubChem CID 43352407) has the molecular formula C12H11NO5S and a molecular weight of 281.29 g/mol. Its IUPAC name is 4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid.

Molecular Properties

Compound Name4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid
PubChem CID43352407
Molecular FormulaC12H11NO5S
Molecular Weight281.29 g/mol
Exact Mass281.04
IUPAC Name4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid
SMILESO=C(O)c1ccc(SCC(=O)N2CCOC2=O)cc1
InChIInChI=1S/C12H11NO5S/c14-10(13-5-6-18-12(13)17)7-19-9-3-1-8(2-4-9)11(15)16/h1-4H,5-7H2,(H,15,16)
InChIKeyUKWWHNNKMIRURL-UHFFFAOYSA-N
XLogP1.46
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.29
LogP ≤ 51.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid?
The IUPAC name of 4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid (CID 43352407) is 4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid.
What is the SMILES notation for 4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid?
The canonical SMILES for 4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid is O=C(O)c1ccc(SCC(=O)N2CCOC2=O)cc1.
What is the InChIKey of 4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid?
The InChIKey is UKWWHNNKMIRURL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO5S/c14-10(13-5-6-18-12(13)17)7-19-9-3-1-8(2-4-9)11(15)16/h1-4H,5-7H2,(H,15,16).
What are the key properties of 4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid?
4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid has a molecular weight of 281.29 g/mol, XLogP of 1.46, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylbenzoic acid is sourced from PubChem (CID 43352407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).