C9H15N5O2S — CID 43352536
3-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methylsulfanyl]propanoic acid (PubChem CID 43352536) has the molecular formula C9H15N5O2S and a molecular weight of 257.32 g/mol. Its IUPAC name is 3-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 43352536 |
| Molecular Formula | C9H15N5O2S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 3-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methylsulfanyl]propanoic acid |
| SMILES | CN(C)c1nc(N)nc(CSCCC(=O)O)n1 |
| InChI | InChI=1S/C9H15N5O2S/c1-14(2)9-12-6(11-8(10)13-9)5-17-4-3-7(15)16/h3-5H2,1-2H3,(H,15,16)(H2,10,11,12,13) |
| InChIKey | GNDXEDZVMPTGJK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|