C10H15N3O4S — CID 43352539
3-[2-oxo-2-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)amino]ethyl]sulfanylpropanoic acid (PubChem CID 43352539) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is 3-[2-oxo-2-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)amino]ethyl]sulfanylpropanoic acid.
| Compound Name | 3-[2-oxo-2-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)amino]ethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43352539 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-[2-oxo-2-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)amino]ethyl]sulfanylpropanoic acid |
| SMILES | CC(C)c1nnc(NC(=O)CSCCC(=O)O)o1 |
| InChI | InChI=1S/C10H15N3O4S/c1-6(2)9-12-13-10(17-9)11-7(14)5-18-4-3-8(15)16/h6H,3-5H2,1-2H3,(H,15,16)(H,11,13,14) |
| InChIKey | XBAWJOUDHIDQTD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|