C7H11N5O2S — CID 43352542
3-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]propanoic acid (PubChem CID 43352542) has the molecular formula C7H11N5O2S and a molecular weight of 229.26 g/mol. Its IUPAC name is 3-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]propanoic acid.
| Compound Name | 3-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 43352542 |
| Molecular Formula | C7H11N5O2S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 3-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]propanoic acid |
| SMILES | Nc1nc(N)nc(CSCCC(=O)O)n1 |
| InChI | InChI=1S/C7H11N5O2S/c8-6-10-4(11-7(9)12-6)3-15-2-1-5(13)14/h1-3H2,(H,13,14)(H4,8,9,10,11,12) |
| InChIKey | VAABFLIFXTZBLT-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 128.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|