About 6-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid
6-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid (PubChem CID 43352930) has the molecular formula C13H19N3O5
and a molecular weight of 297.31 g/mol. Its IUPAC name is 6-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid.
Molecular Properties
| Compound Name | 6-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid |
| PubChem CID | 43352930 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 6-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid |
| SMILES | Cn1c(=O)ccn(CC(=O)NCCCCCC(=O)O)c1=O |
| InChI | InChI=1S/C13H19N3O5/c1-15-11(18)6-8-16(13(15)21)9-10(17)14-7-4-2-3-5-12(19)20/h6,8H,2-5,7,9H2,1H3,(H,14,17)(H,19,20) |
| InChIKey | SSLGDSWHLVFYKJ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid?
The IUPAC name of 6-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid (CID 43352930) is 6-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid.
What is the SMILES notation for 6-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid?
The canonical SMILES for 6-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid is Cn1c(=O)ccn(CC(=O)NCCCCCC(=O)O)c1=O.
What is the InChIKey of 6-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid?
The InChIKey is SSLGDSWHLVFYKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O5/c1-15-11(18)6-8-16(13(15)21)9-10(17)14-7-4-2-3-5-12(19)20/h6,8H,2-5,7,9H2,1H3,(H,14,17)(H,19,20).
What are the key properties of 6-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid?
6-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid has a molecular weight of 297.31 g/mol, XLogP of -0.69, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid is sourced from PubChem (CID 43352930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).