C14H22N2O4S — CID 43352932
6-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]hexanoic acid (PubChem CID 43352932) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 6-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]hexanoic acid.
| Compound Name | 6-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 43352932 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 6-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]hexanoic acid |
| SMILES | Cc1csc(=O)n1CCCC(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C14H22N2O4S/c1-11-10-21-14(20)16(11)9-5-6-12(17)15-8-4-2-3-7-13(18)19/h10H,2-9H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | WAYPAYKLJZWBES-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|