About 4-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]pentanoic acid
4-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]pentanoic acid (PubChem CID 43353333) has the molecular formula C11H17N3O4
and a molecular weight of 255.27 g/mol. Its IUPAC name is 4-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]pentanoic acid.
Molecular Properties
| Compound Name | 4-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]pentanoic acid |
| PubChem CID | 43353333 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 4-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]pentanoic acid |
| SMILES | CC(C)CC(NC(=O)C1=NNC(=O)CC1)C(=O)O |
| InChI | InChI=1S/C11H17N3O4/c1-6(2)5-8(11(17)18)12-10(16)7-3-4-9(15)14-13-7/h6,8H,3-5H2,1-2H3,(H,12,16)(H,14,15)(H,17,18) |
| InChIKey | XRIFRARLKVYRTE-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]pentanoic acid?
The IUPAC name of 4-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]pentanoic acid (CID 43353333) is 4-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]pentanoic acid.
What is the SMILES notation for 4-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]pentanoic acid?
The canonical SMILES for 4-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]pentanoic acid is CC(C)CC(NC(=O)C1=NNC(=O)CC1)C(=O)O.
What is the InChIKey of 4-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]pentanoic acid?
The InChIKey is XRIFRARLKVYRTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O4/c1-6(2)5-8(11(17)18)12-10(16)7-3-4-9(15)14-13-7/h6,8H,3-5H2,1-2H3,(H,12,16)(H,14,15)(H,17,18).
What are the key properties of 4-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]pentanoic acid?
4-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]pentanoic acid has a molecular weight of 255.27 g/mol, XLogP of -0.13, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]pentanoic acid is sourced from PubChem (CID 43353333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).