C10H16F3NO4S — CID 43353413
4-methylsulfanyl-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]butanoic acid (PubChem CID 43353413) has the molecular formula C10H16F3NO4S and a molecular weight of 303.30 g/mol. Its IUPAC name is 4-methylsulfanyl-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]butanoic acid.
| Compound Name | 4-methylsulfanyl-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 43353413 |
| Molecular Formula | C10H16F3NO4S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 4-methylsulfanyl-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]butanoic acid |
| SMILES | CSCCC(NC(=O)CCOCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H16F3NO4S/c1-19-5-3-7(9(16)17)14-8(15)2-4-18-6-10(11,12)13/h7H,2-6H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | KLKRHFTZQIBERB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|