About 3-hydroxy-2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid
3-hydroxy-2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid (PubChem CID 43353581) has the molecular formula C9H14N2O5S
and a molecular weight of 262.29 g/mol. Its IUPAC name is 3-hydroxy-2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid.
Molecular Properties
| Compound Name | 3-hydroxy-2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid |
| PubChem CID | 43353581 |
| Molecular Formula | C9H14N2O5S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 3-hydroxy-2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid |
| SMILES | CC(O)C(NC(=O)CN1CSCC1=O)C(=O)O |
| InChI | InChI=1S/C9H14N2O5S/c1-5(12)8(9(15)16)10-6(13)2-11-4-17-3-7(11)14/h5,8,12H,2-4H2,1H3,(H,10,13)(H,15,16) |
| InChIKey | QBWMJDZSXYNSAE-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-hydroxy-2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid?
The IUPAC name of 3-hydroxy-2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid (CID 43353581) is 3-hydroxy-2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid.
What is the SMILES notation for 3-hydroxy-2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid?
The canonical SMILES for 3-hydroxy-2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid is CC(O)C(NC(=O)CN1CSCC1=O)C(=O)O.
What is the InChIKey of 3-hydroxy-2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid?
The InChIKey is QBWMJDZSXYNSAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O5S/c1-5(12)8(9(15)16)10-6(13)2-11-4-17-3-7(11)14/h5,8,12H,2-4H2,1H3,(H,10,13)(H,15,16).
What are the key properties of 3-hydroxy-2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid?
3-hydroxy-2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid has a molecular weight of 262.29 g/mol, XLogP of -1.53, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid is sourced from PubChem (CID 43353581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).