About 3-hydroxy-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoic acid
3-hydroxy-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoic acid (PubChem CID 43353755) has the molecular formula C9H13N3O5
and a molecular weight of 243.22 g/mol. Its IUPAC name is 3-hydroxy-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoic acid.
Molecular Properties
| Compound Name | 3-hydroxy-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoic acid |
| PubChem CID | 43353755 |
| Molecular Formula | C9H13N3O5 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 3-hydroxy-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoic acid |
| SMILES | CC(O)C(NC(=O)C1=NNC(=O)CC1)C(=O)O |
| InChI | InChI=1S/C9H13N3O5/c1-4(13)7(9(16)17)10-8(15)5-2-3-6(14)12-11-5/h4,7,13H,2-3H2,1H3,(H,10,15)(H,12,14)(H,16,17) |
| InChIKey | SGWZNKKIDTYEOO-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 128.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-hydroxy-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoic acid?
The IUPAC name of 3-hydroxy-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoic acid (CID 43353755) is 3-hydroxy-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoic acid.
What is the SMILES notation for 3-hydroxy-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoic acid?
The canonical SMILES for 3-hydroxy-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoic acid is CC(O)C(NC(=O)C1=NNC(=O)CC1)C(=O)O.
What is the InChIKey of 3-hydroxy-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoic acid?
The InChIKey is SGWZNKKIDTYEOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O5/c1-4(13)7(9(16)17)10-8(15)5-2-3-6(14)12-11-5/h4,7,13H,2-3H2,1H3,(H,10,15)(H,12,14)(H,16,17).
What are the key properties of 3-hydroxy-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoic acid?
3-hydroxy-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoic acid has a molecular weight of 243.22 g/mol, XLogP of -1.80, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoic acid is sourced from PubChem (CID 43353755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).