C9H13N5O3S — CID 43354817
3-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]propanoic acid (PubChem CID 43354817) has the molecular formula C9H13N5O3S and a molecular weight of 271.30 g/mol. Its IUPAC name is 3-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]propanoic acid.
| Compound Name | 3-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43354817 |
| Molecular Formula | C9H13N5O3S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 3-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)CSc1nnnn1C1CC1 |
| InChI | InChI=1S/C9H13N5O3S/c15-7(10-4-3-8(16)17)5-18-9-11-12-13-14(9)6-1-2-6/h6H,1-5H2,(H,10,15)(H,16,17) |
| InChIKey | WDYSFSOXUHAKFB-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |