C12H11F3N2O4 — CID 43355534
1-[2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 43355534) has the molecular formula C12H11F3N2O4 and a molecular weight of 304.22 g/mol. Its IUPAC name is 1-[2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43355534 |
| Molecular Formula | C12H11F3N2O4 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 1-[2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(=O)c1ccc(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C12H11F3N2O4/c13-12(14,15)8-4-3-6(9(18)16-8)10(19)17-5-1-2-7(17)11(20)21/h3-4,7H,1-2,5H2,(H,16,18)(H,20,21) |
| InChIKey | SBXUJMGXEYHHSL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |