C13H17NO3S — CID 43355865
1-(5-ethylthiophene-2-carbonyl)piperidine-3-carboxylic acid (PubChem CID 43355865) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is 1-(5-ethylthiophene-2-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(5-ethylthiophene-2-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 43355865 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1-(5-ethylthiophene-2-carbonyl)piperidine-3-carboxylic acid |
| SMILES | CCc1ccc(C(=O)N2CCCC(C(=O)O)C2)s1 |
| InChI | InChI=1S/C13H17NO3S/c1-2-10-5-6-11(18-10)12(15)14-7-3-4-9(8-14)13(16)17/h5-6,9H,2-4,7-8H2,1H3,(H,16,17) |
| InChIKey | XOXLDGXDBIGVPE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |