C9H10F3N3O3 — CID 43356193
2-[methyl-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]acetic acid (PubChem CID 43356193) has the molecular formula C9H10F3N3O3 and a molecular weight of 265.19 g/mol. Its IUPAC name is 2-[methyl-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]acetic acid.
| Compound Name | 2-[methyl-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 43356193 |
| Molecular Formula | C9H10F3N3O3 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-[methyl-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)Cn1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H10F3N3O3/c1-14(5-8(17)18)7(16)4-15-3-2-6(13-15)9(10,11)12/h2-3H,4-5H2,1H3,(H,17,18) |
| InChIKey | UDQFMKILAJUBGC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |