About 5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]-3-methylthiophene-2-carboxylic acid
5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]-3-methylthiophene-2-carboxylic acid (PubChem CID 43356625) has the molecular formula C13H15N3O3S
and a molecular weight of 293.35 g/mol. Its IUPAC name is 5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]-3-methylthiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]-3-methylthiophene-2-carboxylic acid |
| PubChem CID | 43356625 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]-3-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(NC(=O)Cc2c(C)n[nH]c2C)sc1C(=O)O |
| InChI | InChI=1S/C13H15N3O3S/c1-6-4-11(20-12(6)13(18)19)14-10(17)5-9-7(2)15-16-8(9)3/h4H,5H2,1-3H3,(H,14,17)(H,15,16)(H,18,19) |
| InChIKey | CNKCOZKAEHXMLE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]-3-methylthiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]-3-methylthiophene-2-carboxylic acid?
The IUPAC name of 5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]-3-methylthiophene-2-carboxylic acid (CID 43356625) is 5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]-3-methylthiophene-2-carboxylic acid.
What is the SMILES notation for 5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]-3-methylthiophene-2-carboxylic acid?
The canonical SMILES for 5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]-3-methylthiophene-2-carboxylic acid is Cc1cc(NC(=O)Cc2c(C)n[nH]c2C)sc1C(=O)O.
What is the InChIKey of 5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]-3-methylthiophene-2-carboxylic acid?
The InChIKey is CNKCOZKAEHXMLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O3S/c1-6-4-11(20-12(6)13(18)19)14-10(17)5-9-7(2)15-16-8(9)3/h4H,5H2,1-3H3,(H,14,17)(H,15,16)(H,18,19).
What are the key properties of 5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]-3-methylthiophene-2-carboxylic acid?
5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]-3-methylthiophene-2-carboxylic acid has a molecular weight of 293.35 g/mol, XLogP of 2.28, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]-3-methylthiophene-2-carboxylic acid is sourced from PubChem (CID 43356625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).