About 4-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-4-oxobutanoic acid
4-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-4-oxobutanoic acid (PubChem CID 43357065) has the molecular formula C10H12N4O6
and a molecular weight of 284.23 g/mol. Its IUPAC name is 4-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-4-oxobutanoic acid |
| PubChem CID | 43357065 |
| Molecular Formula | C10H12N4O6 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)Cn1[nH]c(=O)ccc1=O)C(=O)O |
| InChI | InChI=1S/C10H12N4O6/c11-6(15)3-5(10(19)20)12-8(17)4-14-9(18)2-1-7(16)13-14/h1-2,5H,3-4H2,(H2,11,15)(H,12,17)(H,13,16)(H,19,20) |
| InChIKey | HBMNYZXFKLTJJN-UHFFFAOYSA-N |
| XLogP | -3.02 |
| TPSA | 164.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-4-oxobutanoic acid?
The IUPAC name of 4-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-4-oxobutanoic acid (CID 43357065) is 4-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-4-oxobutanoic acid.
What is the SMILES notation for 4-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-4-oxobutanoic acid?
The canonical SMILES for 4-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-4-oxobutanoic acid is NC(=O)CC(NC(=O)Cn1[nH]c(=O)ccc1=O)C(=O)O.
What is the InChIKey of 4-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-4-oxobutanoic acid?
The InChIKey is HBMNYZXFKLTJJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O6/c11-6(15)3-5(10(19)20)12-8(17)4-14-9(18)2-1-7(16)13-14/h1-2,5H,3-4H2,(H2,11,15)(H,12,17)(H,13,16)(H,19,20).
What are the key properties of 4-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-4-oxobutanoic acid?
4-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-4-oxobutanoic acid has a molecular weight of 284.23 g/mol, XLogP of -3.02, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-4-oxobutanoic acid is sourced from PubChem (CID 43357065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).