C12H22N4O5 — CID 43358642
5-amino-2-[[2-(carbamoylamino)-4-methylpentanoyl]amino]-5-oxopentanoic acid (PubChem CID 43358642) has the molecular formula C12H22N4O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is 5-amino-2-[[2-(carbamoylamino)-4-methylpentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-(carbamoylamino)-4-methylpentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 43358642 |
| Molecular Formula | C12H22N4O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 5-amino-2-[[2-(carbamoylamino)-4-methylpentanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)CC(NC(N)=O)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C12H22N4O5/c1-6(2)5-8(16-12(14)21)10(18)15-7(11(19)20)3-4-9(13)17/h6-8H,3-5H2,1-2H3,(H2,13,17)(H,15,18)(H,19,20)(H3,14,16,21) |
| InChIKey | WQIVTPPWPWWKHX-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |