About 7-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]heptanoic acid
7-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]heptanoic acid (PubChem CID 43358976) has the molecular formula C15H22N2O4
and a molecular weight of 294.35 g/mol. Its IUPAC name is 7-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]heptanoic acid.
Molecular Properties
| Compound Name | 7-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]heptanoic acid |
| PubChem CID | 43358976 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 7-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]heptanoic acid |
| SMILES | Cc1cc(C)c(C(=O)NCCCCCCC(=O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C15H22N2O4/c1-10-9-11(2)17-15(21)13(10)14(20)16-8-6-4-3-5-7-12(18)19/h9H,3-8H2,1-2H3,(H,16,20)(H,17,21)(H,18,19) |
| InChIKey | XIZUXBOZDNJNMY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]heptanoic acid?
The IUPAC name of 7-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]heptanoic acid (CID 43358976) is 7-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]heptanoic acid.
What is the SMILES notation for 7-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]heptanoic acid?
The canonical SMILES for 7-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]heptanoic acid is Cc1cc(C)c(C(=O)NCCCCCCC(=O)O)c(=O)[nH]1.
What is the InChIKey of 7-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]heptanoic acid?
The InChIKey is XIZUXBOZDNJNMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O4/c1-10-9-11(2)17-15(21)13(10)14(20)16-8-6-4-3-5-7-12(18)19/h9H,3-8H2,1-2H3,(H,16,20)(H,17,21)(H,18,19).
What are the key properties of 7-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]heptanoic acid?
7-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]heptanoic acid has a molecular weight of 294.35 g/mol, XLogP of 1.76, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]heptanoic acid is sourced from PubChem (CID 43358976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).