C10H16F3NO4 — CID 43359982
4-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]butanoic acid (PubChem CID 43359982) has the molecular formula C10H16F3NO4 and a molecular weight of 271.23 g/mol. Its IUPAC name is 4-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]butanoic acid.
| Compound Name | 4-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43359982 |
| Molecular Formula | C10H16F3NO4 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C10H16F3NO4/c1-14(5-2-3-9(16)17)8(15)4-6-18-7-10(11,12)13/h2-7H2,1H3,(H,16,17) |
| InChIKey | VNTIXBZZEIGYHJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|