C11H15N3O4 — CID 43360045
4-[methyl-[2-(2-oxopyrimidin-1-yl)acetyl]amino]butanoic acid (PubChem CID 43360045) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 4-[methyl-[2-(2-oxopyrimidin-1-yl)acetyl]amino]butanoic acid.
| Compound Name | 4-[methyl-[2-(2-oxopyrimidin-1-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43360045 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-[methyl-[2-(2-oxopyrimidin-1-yl)acetyl]amino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)Cn1cccnc1=O |
| InChI | InChI=1S/C11H15N3O4/c1-13(6-2-4-10(16)17)9(15)8-14-7-3-5-12-11(14)18/h3,5,7H,2,4,6,8H2,1H3,(H,16,17) |
| InChIKey | DVRPQUKUQCRYDD-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |