C12H17N3O4S — CID 43360145
4-[methyl-(6-methyl-4-methylsulfanyl-2-oxo-1H-pyrimidine-5-carbonyl)amino]butanoic acid (PubChem CID 43360145) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 4-[methyl-(6-methyl-4-methylsulfanyl-2-oxo-1H-pyrimidine-5-carbonyl)amino]butanoic acid.
| Compound Name | 4-[methyl-(6-methyl-4-methylsulfanyl-2-oxo-1H-pyrimidine-5-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 43360145 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 4-[methyl-(6-methyl-4-methylsulfanyl-2-oxo-1H-pyrimidine-5-carbonyl)amino]butanoic acid |
| SMILES | CSc1nc(=O)[nH]c(C)c1C(=O)N(C)CCCC(=O)O |
| InChI | InChI=1S/C12H17N3O4S/c1-7-9(10(20-3)14-12(19)13-7)11(18)15(2)6-4-5-8(16)17/h4-6H2,1-3H3,(H,16,17)(H,13,14,19) |
| InChIKey | HUWVJPNYGXGJAZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |