C16H21NO3 — CID 43360529
2-cyclopropyl-2-[3-(4-methylphenyl)propanoylamino]propanoic acid (PubChem CID 43360529) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-cyclopropyl-2-[3-(4-methylphenyl)propanoylamino]propanoic acid.
| Compound Name | 2-cyclopropyl-2-[3-(4-methylphenyl)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 43360529 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-cyclopropyl-2-[3-(4-methylphenyl)propanoylamino]propanoic acid |
| SMILES | Cc1ccc(CCC(=O)NC(C)(C(=O)O)C2CC2)cc1 |
| InChI | InChI=1S/C16H21NO3/c1-11-3-5-12(6-4-11)7-10-14(18)17-16(2,15(19)20)13-8-9-13/h3-6,13H,7-10H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | GEONXEHYPBJYDX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |