C10H15N5O3S — CID 43360896
3-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]butanoic acid (PubChem CID 43360896) has the molecular formula C10H15N5O3S and a molecular weight of 285.33 g/mol. Its IUPAC name is 3-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]butanoic acid.
| Compound Name | 3-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43360896 |
| Molecular Formula | C10H15N5O3S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 3-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)CSc1nnnn1C1CC1 |
| InChI | InChI=1S/C10H15N5O3S/c1-6(4-9(17)18)11-8(16)5-19-10-12-13-14-15(10)7-2-3-7/h6-7H,2-5H2,1H3,(H,11,16)(H,17,18) |
| InChIKey | LIAXVGGUDFIXLN-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |