C10H12FNO4S — CID 43361295
2-[(4-fluorophenyl)methylsulfonylamino]propanoic acid (PubChem CID 43361295) has the molecular formula C10H12FNO4S and a molecular weight of 261.27 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfonylamino]propanoic acid.
| Compound Name | 2-[(4-fluorophenyl)methylsulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 43361295 |
| Molecular Formula | C10H12FNO4S |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfonylamino]propanoic acid |
| SMILES | CC(NS(=O)(=O)Cc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C10H12FNO4S/c1-7(10(13)14)12-17(15,16)6-8-2-4-9(11)5-3-8/h2-5,7,12H,6H2,1H3,(H,13,14) |
| InChIKey | CFPUGXSCHVQCSO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |