C12H12Cl3NO4S — CID 43361631
2-cyclopropyl-2-[(2,4,6-trichlorophenyl)sulfonylamino]propanoic acid (PubChem CID 43361631) has the molecular formula C12H12Cl3NO4S and a molecular weight of 372.66 g/mol. Its IUPAC name is 2-cyclopropyl-2-[(2,4,6-trichlorophenyl)sulfonylamino]propanoic acid.
| Compound Name | 2-cyclopropyl-2-[(2,4,6-trichlorophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 43361631 |
| Molecular Formula | C12H12Cl3NO4S |
| Molecular Weight | 372.66 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | 2-cyclopropyl-2-[(2,4,6-trichlorophenyl)sulfonylamino]propanoic acid |
| SMILES | CC(NS(=O)(=O)c1c(Cl)cc(Cl)cc1Cl)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C12H12Cl3NO4S/c1-12(11(17)18,6-2-3-6)16-21(19,20)10-8(14)4-7(13)5-9(10)15/h4-6,16H,2-3H2,1H3,(H,17,18) |
| InChIKey | DVZZIJPGUOZMTB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.66 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |