C9H14F3NO4S — CID 43361680
1-(trifluoromethylsulfonylamino)cycloheptane-1-carboxylic acid (PubChem CID 43361680) has the molecular formula C9H14F3NO4S and a molecular weight of 289.28 g/mol. Its IUPAC name is 1-(trifluoromethylsulfonylamino)cycloheptane-1-carboxylic acid.
| Compound Name | 1-(trifluoromethylsulfonylamino)cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 43361680 |
| Molecular Formula | C9H14F3NO4S |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 1-(trifluoromethylsulfonylamino)cycloheptane-1-carboxylic acid |
| SMILES | O=C(O)C1(NS(=O)(=O)C(F)(F)F)CCCCCC1 |
| InChI | InChI=1S/C9H14F3NO4S/c10-9(11,12)18(16,17)13-8(7(14)15)5-3-1-2-4-6-8/h13H,1-6H2,(H,14,15) |
| InChIKey | ZHXNDBRIAZLXFK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |