About 5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-3H-1,3-thiazol-2-one
5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-3H-1,3-thiazol-2-one (PubChem CID 43361724) has the molecular formula C9H15N3O3S2
and a molecular weight of 277.37 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-3H-1,3-thiazol-2-one |
| PubChem CID | 43361724 |
| Molecular Formula | C9H15N3O3S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-3H-1,3-thiazol-2-one |
| SMILES | Cc1[nH]c(=O)sc1S(=O)(=O)N1CCCNCC1 |
| InChI | InChI=1S/C9H15N3O3S2/c1-7-8(16-9(13)11-7)17(14,15)12-5-2-3-10-4-6-12/h10H,2-6H2,1H3,(H,11,13) |
| InChIKey | ZSLUJYRJBGIUCS-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-3H-1,3-thiazol-2-one?
The IUPAC name of 5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-3H-1,3-thiazol-2-one (CID 43361724) is 5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-3H-1,3-thiazol-2-one.
What is the SMILES notation for 5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-3H-1,3-thiazol-2-one?
The canonical SMILES for 5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-3H-1,3-thiazol-2-one is Cc1[nH]c(=O)sc1S(=O)(=O)N1CCCNCC1.
What is the InChIKey of 5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-3H-1,3-thiazol-2-one?
The InChIKey is ZSLUJYRJBGIUCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3S2/c1-7-8(16-9(13)11-7)17(14,15)12-5-2-3-10-4-6-12/h10H,2-6H2,1H3,(H,11,13).
What are the key properties of 5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-3H-1,3-thiazol-2-one?
5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-3H-1,3-thiazol-2-one has a molecular weight of 277.37 g/mol, XLogP of -0.27, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-3H-1,3-thiazol-2-one is sourced from PubChem (CID 43361724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).