C10H12ClNO4S — CID 43361907
2-[1-(4-chlorophenyl)ethylsulfamoyl]acetic acid (PubChem CID 43361907) has the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)ethylsulfamoyl]acetic acid.
| Compound Name | 2-[1-(4-chlorophenyl)ethylsulfamoyl]acetic acid |
|---|---|
| PubChem CID | 43361907 |
| Molecular Formula | C10H12ClNO4S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2-[1-(4-chlorophenyl)ethylsulfamoyl]acetic acid |
| SMILES | CC(NS(=O)(=O)CC(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H12ClNO4S/c1-7(8-2-4-9(11)5-3-8)12-17(15,16)6-10(13)14/h2-5,7,12H,6H2,1H3,(H,13,14) |
| InChIKey | RJPWXJBILIISOB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |