C12H12N2O5S — CID 43362452
4-[(5-methyl-1,2-oxazol-3-yl)sulfamoylmethyl]benzoic acid (PubChem CID 43362452) has the molecular formula C12H12N2O5S and a molecular weight of 296.30 g/mol. Its IUPAC name is 4-[(5-methyl-1,2-oxazol-3-yl)sulfamoylmethyl]benzoic acid.
| Compound Name | 4-[(5-methyl-1,2-oxazol-3-yl)sulfamoylmethyl]benzoic acid |
|---|---|
| PubChem CID | 43362452 |
| Molecular Formula | C12H12N2O5S |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 4-[(5-methyl-1,2-oxazol-3-yl)sulfamoylmethyl]benzoic acid |
| SMILES | Cc1cc(NS(=O)(=O)Cc2ccc(C(=O)O)cc2)no1 |
| InChI | InChI=1S/C12H12N2O5S/c1-8-6-11(13-19-8)14-20(17,18)7-9-2-4-10(5-3-9)12(15)16/h2-6H,7H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | PSKGRLVQFCFLQL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |