4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid

C10H5Cl3N2O3 — CID 43363605

IUPAC4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid
SMILESO=C(O)c1nn(-c2cc(Cl)c(Cl)cc2Cl)cc1O
InChIInChI=1S/C10H5Cl3N2O3/c11-4-1-6(13)7(2-5(4)12)15-3-8(16)9(14-15)10(17)18/h1-3,16H,(H,17,18)
InChIKeyHEHODTXZHOSVAM-UHFFFAOYSA-N
MW307.52 g/mol
LogP3.24
Rot. Bonds2

About 4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid

4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid (PubChem CID 43363605) has the molecular formula C10H5Cl3N2O3 and a molecular weight of 307.52 g/mol. Its IUPAC name is 4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid.

Molecular Properties

Compound Name4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid
PubChem CID43363605
Molecular FormulaC10H5Cl3N2O3
Molecular Weight307.52 g/mol
Exact Mass305.94
IUPAC Name4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid
SMILESO=C(O)c1nn(-c2cc(Cl)c(Cl)cc2Cl)cc1O
InChIInChI=1S/C10H5Cl3N2O3/c11-4-1-6(13)7(2-5(4)12)15-3-8(16)9(14-15)10(17)18/h1-3,16H,(H,17,18)
InChIKeyHEHODTXZHOSVAM-UHFFFAOYSA-N
XLogP3.24
TPSA75.35 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.52
LogP ≤ 53.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid?
The IUPAC name of 4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid (CID 43363605) is 4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid.
What is the SMILES notation for 4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid?
The canonical SMILES for 4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid is O=C(O)c1nn(-c2cc(Cl)c(Cl)cc2Cl)cc1O.
What is the InChIKey of 4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid?
The InChIKey is HEHODTXZHOSVAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Cl3N2O3/c11-4-1-6(13)7(2-5(4)12)15-3-8(16)9(14-15)10(17)18/h1-3,16H,(H,17,18).
What are the key properties of 4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid?
4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid has a molecular weight of 307.52 g/mol, XLogP of 3.24, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid is sourced from PubChem (CID 43363605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).