C12H8ClN3OS — CID 43364090
3-chloro-4-thieno[3,2-d]pyrimidin-4-yloxyaniline (PubChem CID 43364090) has the molecular formula C12H8ClN3OS and a molecular weight of 277.74 g/mol. Its IUPAC name is 3-chloro-4-thieno[3,2-d]pyrimidin-4-yloxyaniline.
| Compound Name | 3-chloro-4-thieno[3,2-d]pyrimidin-4-yloxyaniline |
|---|---|
| PubChem CID | 43364090 |
| Molecular Formula | C12H8ClN3OS |
| Molecular Weight | 277.74 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 3-chloro-4-thieno[3,2-d]pyrimidin-4-yloxyaniline |
| SMILES | Nc1ccc(Oc2ncnc3ccsc23)c(Cl)c1 |
| InChI | InChI=1S/C12H8ClN3OS/c13-8-5-7(14)1-2-10(8)17-12-11-9(3-4-18-11)15-6-16-12/h1-6H,14H2 |
| InChIKey | VPCPEWGECWFALI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.74 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|