About 3-(3,5-dimethylpiperidin-1-yl)-2-methylpropanethioamide
3-(3,5-dimethylpiperidin-1-yl)-2-methylpropanethioamide (PubChem CID 43367734) has the molecular formula C11H22N2S
and a molecular weight of 214.38 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidin-1-yl)-2-methylpropanethioamide.
Molecular Properties
| Compound Name | 3-(3,5-dimethylpiperidin-1-yl)-2-methylpropanethioamide |
| PubChem CID | 43367734 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 3-(3,5-dimethylpiperidin-1-yl)-2-methylpropanethioamide |
| SMILES | CC1CC(C)CN(CC(C)C(N)=S)C1 |
| InChI | InChI=1S/C11H22N2S/c1-8-4-9(2)6-13(5-8)7-10(3)11(12)14/h8-10H,4-7H2,1-3H3,(H2,12,14) |
| InChIKey | ZFUQARNCJXWVAH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dimethylpiperidin-1-yl)-2-methylpropanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethylpiperidin-1-yl)-2-methylpropanethioamide?
The IUPAC name of 3-(3,5-dimethylpiperidin-1-yl)-2-methylpropanethioamide (CID 43367734) is 3-(3,5-dimethylpiperidin-1-yl)-2-methylpropanethioamide.
What is the SMILES notation for 3-(3,5-dimethylpiperidin-1-yl)-2-methylpropanethioamide?
The canonical SMILES for 3-(3,5-dimethylpiperidin-1-yl)-2-methylpropanethioamide is CC1CC(C)CN(CC(C)C(N)=S)C1.
What is the InChIKey of 3-(3,5-dimethylpiperidin-1-yl)-2-methylpropanethioamide?
The InChIKey is ZFUQARNCJXWVAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2S/c1-8-4-9(2)6-13(5-8)7-10(3)11(12)14/h8-10H,4-7H2,1-3H3,(H2,12,14).
What are the key properties of 3-(3,5-dimethylpiperidin-1-yl)-2-methylpropanethioamide?
3-(3,5-dimethylpiperidin-1-yl)-2-methylpropanethioamide has a molecular weight of 214.38 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethylpiperidin-1-yl)-2-methylpropanethioamide is sourced from PubChem (CID 43367734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).