About N'-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxy)propanimidamide
N'-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxy)propanimidamide (PubChem CID 43368391) has the molecular formula C6H11F3N2O2
and a molecular weight of 200.16 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxy)propanimidamide.
Molecular Properties
| Compound Name | N'-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxy)propanimidamide |
| PubChem CID | 43368391 |
| Molecular Formula | C6H11F3N2O2 |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | N'-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxy)propanimidamide |
| SMILES | CC(COCC(F)(F)F)/C(N)=N/O |
| InChI | InChI=1S/C6H11F3N2O2/c1-4(5(10)11-12)2-13-3-6(7,8)9/h4,12H,2-3H2,1H3,(H2,10,11) |
| InChIKey | FIEJLXHEIZLCKV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxy)propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxy)propanimidamide?
The IUPAC name of N'-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxy)propanimidamide (CID 43368391) is N'-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxy)propanimidamide.
What is the SMILES notation for N'-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxy)propanimidamide?
The canonical SMILES for N'-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxy)propanimidamide is CC(COCC(F)(F)F)/C(N)=N/O.
What is the InChIKey of N'-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxy)propanimidamide?
The InChIKey is FIEJLXHEIZLCKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F3N2O2/c1-4(5(10)11-12)2-13-3-6(7,8)9/h4,12H,2-3H2,1H3,(H2,10,11).
What are the key properties of N'-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxy)propanimidamide?
N'-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxy)propanimidamide has a molecular weight of 200.16 g/mol, XLogP of 0.95, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxy)propanimidamide is sourced from PubChem (CID 43368391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).