About 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanethioamide
2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanethioamide (PubChem CID 43368678) has the molecular formula C14H14N2OS3
and a molecular weight of 322.48 g/mol. Its IUPAC name is 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanethioamide.
Molecular Properties
| Compound Name | 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanethioamide |
| PubChem CID | 43368678 |
| Molecular Formula | C14H14N2OS3 |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanethioamide |
| SMILES | Cc1nc2c(cc(OCC(C)C(N)=S)c3ccsc32)s1 |
| InChI | InChI=1S/C14H14N2OS3/c1-7(14(15)18)6-17-10-5-11-12(16-8(2)20-11)13-9(10)3-4-19-13/h3-5,7H,6H2,1-2H3,(H2,15,18) |
| InChIKey | TXMCIWMCGAPNCW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanethioamide?
The IUPAC name of 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanethioamide (CID 43368678) is 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanethioamide.
What is the SMILES notation for 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanethioamide?
The canonical SMILES for 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanethioamide is Cc1nc2c(cc(OCC(C)C(N)=S)c3ccsc32)s1.
What is the InChIKey of 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanethioamide?
The InChIKey is TXMCIWMCGAPNCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2OS3/c1-7(14(15)18)6-17-10-5-11-12(16-8(2)20-11)13-9(10)3-4-19-13/h3-5,7H,6H2,1-2H3,(H2,15,18).
What are the key properties of 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanethioamide?
2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanethioamide has a molecular weight of 322.48 g/mol, XLogP of 4.12, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanethioamide is sourced from PubChem (CID 43368678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).