C7H12F4N2O2 — CID 43368846
N'-hydroxy-2-methyl-3-(2,2,3,3-tetrafluoropropoxy)propanimidamide (PubChem CID 43368846) has the molecular formula C7H12F4N2O2 and a molecular weight of 232.18 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-3-(2,2,3,3-tetrafluoropropoxy)propanimidamide.
| Compound Name | N'-hydroxy-2-methyl-3-(2,2,3,3-tetrafluoropropoxy)propanimidamide |
|---|---|
| PubChem CID | 43368846 |
| Molecular Formula | C7H12F4N2O2 |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N'-hydroxy-2-methyl-3-(2,2,3,3-tetrafluoropropoxy)propanimidamide |
| SMILES | CC(COCC(F)(F)C(F)F)/C(N)=N/O |
| InChI | InChI=1S/C7H12F4N2O2/c1-4(5(12)13-14)2-15-3-7(10,11)6(8)9/h4,6,14H,2-3H2,1H3,(H2,12,13) |
| InChIKey | DVLGQTAPBKUFHI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|