C15H23ClN2O — CID 43368956
3-(4-chloro-2-methyl-5-propan-2-ylphenoxy)pentanimidamide (PubChem CID 43368956) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is 3-(4-chloro-2-methyl-5-propan-2-ylphenoxy)pentanimidamide.
| Compound Name | 3-(4-chloro-2-methyl-5-propan-2-ylphenoxy)pentanimidamide |
|---|---|
| PubChem CID | 43368956 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 3-(4-chloro-2-methyl-5-propan-2-ylphenoxy)pentanimidamide |
| SMILES | [H]/N=C(\N)CC(CC)Oc1cc(C(C)C)c(Cl)cc1C |
| InChI | InChI=1S/C15H23ClN2O/c1-5-11(7-15(17)18)19-14-8-12(9(2)3)13(16)6-10(14)4/h6,8-9,11H,5,7H2,1-4H3,(H3,17,18) |
| InChIKey | OSOFODIEICFOKO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|