C16H14N2O3 — CID 43369113
N-[4-(cyanomethoxy)phenyl]-3-hydroxy-4-methylbenzamide (PubChem CID 43369113) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is N-[4-(cyanomethoxy)phenyl]-3-hydroxy-4-methylbenzamide.
| Compound Name | N-[4-(cyanomethoxy)phenyl]-3-hydroxy-4-methylbenzamide |
|---|---|
| PubChem CID | 43369113 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-[4-(cyanomethoxy)phenyl]-3-hydroxy-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(OCC#N)cc2)cc1O |
| InChI | InChI=1S/C16H14N2O3/c1-11-2-3-12(10-15(11)19)16(20)18-13-4-6-14(7-5-13)21-9-8-17/h2-7,10,19H,9H2,1H3,(H,18,20) |
| InChIKey | OIHLHCZXYBJVKL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |