C16H20N2O2 — CID 43369129
N-[3-(cyanomethoxy)phenyl]-2-cyclohexylacetamide (PubChem CID 43369129) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[3-(cyanomethoxy)phenyl]-2-cyclohexylacetamide.
| Compound Name | N-[3-(cyanomethoxy)phenyl]-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 43369129 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[3-(cyanomethoxy)phenyl]-2-cyclohexylacetamide |
| SMILES | N#CCOc1cccc(NC(=O)CC2CCCCC2)c1 |
| InChI | InChI=1S/C16H20N2O2/c17-9-10-20-15-8-4-7-14(12-15)18-16(19)11-13-5-2-1-3-6-13/h4,7-8,12-13H,1-3,5-6,10-11H2,(H,18,19) |
| InChIKey | KNXRPWOABCJCQW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |