About 2-(2,4-difluorophenyl)-1,3-dihydroisoindol-5-amine
2-(2,4-difluorophenyl)-1,3-dihydroisoindol-5-amine (PubChem CID 43370159) has the molecular formula C14H12F2N2
and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1,3-dihydroisoindol-5-amine.
Molecular Properties
| Compound Name | 2-(2,4-difluorophenyl)-1,3-dihydroisoindol-5-amine |
| PubChem CID | 43370159 |
| Molecular Formula | C14H12F2N2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1,3-dihydroisoindol-5-amine |
| SMILES | Nc1ccc2c(c1)CN(c1ccc(F)cc1F)C2 |
| InChI | InChI=1S/C14H12F2N2/c15-11-2-4-14(13(16)6-11)18-7-9-1-3-12(17)5-10(9)8-18/h1-6H,7-8,17H2 |
| InChIKey | KFMGYICTUMGQOK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-difluorophenyl)-1,3-dihydroisoindol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-difluorophenyl)-1,3-dihydroisoindol-5-amine?
The IUPAC name of 2-(2,4-difluorophenyl)-1,3-dihydroisoindol-5-amine (CID 43370159) is 2-(2,4-difluorophenyl)-1,3-dihydroisoindol-5-amine.
What is the SMILES notation for 2-(2,4-difluorophenyl)-1,3-dihydroisoindol-5-amine?
The canonical SMILES for 2-(2,4-difluorophenyl)-1,3-dihydroisoindol-5-amine is Nc1ccc2c(c1)CN(c1ccc(F)cc1F)C2.
What is the InChIKey of 2-(2,4-difluorophenyl)-1,3-dihydroisoindol-5-amine?
The InChIKey is KFMGYICTUMGQOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2N2/c15-11-2-4-14(13(16)6-11)18-7-9-1-3-12(17)5-10(9)8-18/h1-6H,7-8,17H2.
What are the key properties of 2-(2,4-difluorophenyl)-1,3-dihydroisoindol-5-amine?
2-(2,4-difluorophenyl)-1,3-dihydroisoindol-5-amine has a molecular weight of 246.26 g/mol, XLogP of 3.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-difluorophenyl)-1,3-dihydroisoindol-5-amine is sourced from PubChem (CID 43370159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).