About 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine
5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine (PubChem CID 43370279) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine.
Analyze 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine?
The IUPAC name of 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine (CID 43370279) is 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine.
What is the SMILES notation for 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine?
The canonical SMILES for 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine is NC1CCc2nccn2C1.
What is the InChIKey of 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine?
The InChIKey is DMGFKLHPPROGNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c8-6-1-2-7-9-3-4-10(7)5-6/h3-4,6H,1-2,5,8H2.
What are the key properties of 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine?
5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine has a molecular weight of 137.19 g/mol, XLogP of 0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine is sourced from PubChem (CID 43370279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).