About 1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-amine
1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-amine (PubChem CID 43370493) has the molecular formula C13H19Cl2N
and a molecular weight of 260.21 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-amine.
Molecular Properties
| Compound Name | 1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-amine |
| PubChem CID | 43370493 |
| Molecular Formula | C13H19Cl2N |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-amine |
| SMILES | CC(C)(C)C(N)CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H19Cl2N/c1-13(2,3)12(16)7-5-9-4-6-10(14)8-11(9)15/h4,6,8,12H,5,7,16H2,1-3H3 |
| InChIKey | IPIJLMABDDHRPZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-amine?
The IUPAC name of 1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-amine (CID 43370493) is 1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-amine.
What is the SMILES notation for 1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-amine?
The canonical SMILES for 1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-amine is CC(C)(C)C(N)CCc1ccc(Cl)cc1Cl.
What is the InChIKey of 1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-amine?
The InChIKey is IPIJLMABDDHRPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19Cl2N/c1-13(2,3)12(16)7-5-9-4-6-10(14)8-11(9)15/h4,6,8,12H,5,7,16H2,1-3H3.
What are the key properties of 1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-amine?
1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-amine has a molecular weight of 260.21 g/mol, XLogP of 4.30, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-amine is sourced from PubChem (CID 43370493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).