About N-(4-methylpentan-2-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine
N-(4-methylpentan-2-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 43372388) has the molecular formula C10H20N2S
and a molecular weight of 200.35 g/mol. Its IUPAC name is N-(4-methylpentan-2-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
Molecular Properties
| Compound Name | N-(4-methylpentan-2-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| PubChem CID | 43372388 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | N-(4-methylpentan-2-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | CC(C)CC(C)NC1=NCCCS1 |
| InChI | InChI=1S/C10H20N2S/c1-8(2)7-9(3)12-10-11-5-4-6-13-10/h8-9H,4-7H2,1-3H3,(H,11,12) |
| InChIKey | GOUOPRZVCAYESY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-methylpentan-2-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylpentan-2-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The IUPAC name of N-(4-methylpentan-2-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine (CID 43372388) is N-(4-methylpentan-2-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
What is the SMILES notation for N-(4-methylpentan-2-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The canonical SMILES for N-(4-methylpentan-2-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine is CC(C)CC(C)NC1=NCCCS1.
What is the InChIKey of N-(4-methylpentan-2-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The InChIKey is GOUOPRZVCAYESY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2S/c1-8(2)7-9(3)12-10-11-5-4-6-13-10/h8-9H,4-7H2,1-3H3,(H,11,12).
What are the key properties of N-(4-methylpentan-2-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
N-(4-methylpentan-2-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine has a molecular weight of 200.35 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylpentan-2-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine is sourced from PubChem (CID 43372388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).