C10H18ClN3O2 — CID 43373716
3-chloro-N-[(1-methylpiperidin-4-yl)carbamoyl]propanamide (PubChem CID 43373716) has the molecular formula C10H18ClN3O2 and a molecular weight of 247.73 g/mol. Its IUPAC name is 3-chloro-N-[(1-methylpiperidin-4-yl)carbamoyl]propanamide.
| Compound Name | 3-chloro-N-[(1-methylpiperidin-4-yl)carbamoyl]propanamide |
|---|---|
| PubChem CID | 43373716 |
| Molecular Formula | C10H18ClN3O2 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3-chloro-N-[(1-methylpiperidin-4-yl)carbamoyl]propanamide |
| SMILES | CN1CCC(NC(=O)NC(=O)CCCl)CC1 |
| InChI | InChI=1S/C10H18ClN3O2/c1-14-6-3-8(4-7-14)12-10(16)13-9(15)2-5-11/h8H,2-7H2,1H3,(H2,12,13,15,16) |
| InChIKey | KKSUNNKEUSNTIO-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|