C13H21N3O3 — CID 43374456
2-[[3-(2-aminophenoxy)-2-hydroxypropyl]-methylamino]-N-methylacetamide (PubChem CID 43374456) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-[[3-(2-aminophenoxy)-2-hydroxypropyl]-methylamino]-N-methylacetamide.
| Compound Name | 2-[[3-(2-aminophenoxy)-2-hydroxypropyl]-methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 43374456 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-[[3-(2-aminophenoxy)-2-hydroxypropyl]-methylamino]-N-methylacetamide |
| SMILES | CNC(=O)CN(C)CC(O)COc1ccccc1N |
| InChI | InChI=1S/C13H21N3O3/c1-15-13(18)8-16(2)7-10(17)9-19-12-6-4-3-5-11(12)14/h3-6,10,17H,7-9,14H2,1-2H3,(H,15,18) |
| InChIKey | IQLUBRZWTHJVAD-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|