C14H20N4O2S — CID 43374980
N-(3-carbamothioylphenyl)-2-[methyl-[2-(methylamino)-2-oxoethyl]amino]propanamide (PubChem CID 43374980) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is N-(3-carbamothioylphenyl)-2-[methyl-[2-(methylamino)-2-oxoethyl]amino]propanamide.
| Compound Name | N-(3-carbamothioylphenyl)-2-[methyl-[2-(methylamino)-2-oxoethyl]amino]propanamide |
|---|---|
| PubChem CID | 43374980 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-(3-carbamothioylphenyl)-2-[methyl-[2-(methylamino)-2-oxoethyl]amino]propanamide |
| SMILES | CNC(=O)CN(C)C(C)C(=O)Nc1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C14H20N4O2S/c1-9(18(3)8-12(19)16-2)14(20)17-11-6-4-5-10(7-11)13(15)21/h4-7,9H,8H2,1-3H3,(H2,15,21)(H,16,19)(H,17,20) |
| InChIKey | LESHMUDREXZJIK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|