C15H22N4 — CID 43375602
2-[[cyclohexyl(methyl)amino]methyl]-3H-benzimidazol-5-amine (PubChem CID 43375602) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-[[cyclohexyl(methyl)amino]methyl]-3H-benzimidazol-5-amine.
| Compound Name | 2-[[cyclohexyl(methyl)amino]methyl]-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 43375602 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-[[cyclohexyl(methyl)amino]methyl]-3H-benzimidazol-5-amine |
| SMILES | CN(Cc1nc2ccc(N)cc2[nH]1)C1CCCCC1 |
| InChI | InChI=1S/C15H22N4/c1-19(12-5-3-2-4-6-12)10-15-17-13-8-7-11(16)9-14(13)18-15/h7-9,12H,2-6,10,16H2,1H3,(H,17,18) |
| InChIKey | KHPATIKMFNROOF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|