C13H14N4O4 — CID 43376263
N-(4-aminophenyl)-N-methyl-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide (PubChem CID 43376263) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is N-(4-aminophenyl)-N-methyl-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(4-aminophenyl)-N-methyl-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 43376263 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | N-(4-aminophenyl)-N-methyl-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
| SMILES | CN1C(=O)C(=O)N(CC(=O)N(C)c2ccc(N)cc2)C1=O |
| InChI | InChI=1S/C13H14N4O4/c1-15(9-5-3-8(14)4-6-9)10(18)7-17-12(20)11(19)16(2)13(17)21/h3-6H,7,14H2,1-2H3 |
| InChIKey | SQXAVTRQOBIAQR-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|