C17H20N2 — CID 43378747
2-(4-propylphenyl)-1,3-dihydroisoindol-4-amine (PubChem CID 43378747) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-(4-propylphenyl)-1,3-dihydroisoindol-4-amine.
| Compound Name | 2-(4-propylphenyl)-1,3-dihydroisoindol-4-amine |
|---|---|
| PubChem CID | 43378747 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2-(4-propylphenyl)-1,3-dihydroisoindol-4-amine |
| SMILES | CCCc1ccc(N2Cc3cccc(N)c3C2)cc1 |
| InChI | InChI=1S/C17H20N2/c1-2-4-13-7-9-15(10-8-13)19-11-14-5-3-6-17(18)16(14)12-19/h3,5-10H,2,4,11-12,18H2,1H3 |
| InChIKey | FZXGMNCSAAMSGB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|