C14H11Cl2NO3 — CID 43379751
3-amino-4-[(2,4-dichlorophenyl)methoxy]benzoic acid (PubChem CID 43379751) has the molecular formula C14H11Cl2NO3 and a molecular weight of 312.15 g/mol. Its IUPAC name is 3-amino-4-[(2,4-dichlorophenyl)methoxy]benzoic acid.
| Compound Name | 3-amino-4-[(2,4-dichlorophenyl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 43379751 |
| Molecular Formula | C14H11Cl2NO3 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 3-amino-4-[(2,4-dichlorophenyl)methoxy]benzoic acid |
| SMILES | Nc1cc(C(=O)O)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl2NO3/c15-10-3-1-9(11(16)6-10)7-20-13-4-2-8(14(18)19)5-12(13)17/h1-6H,7,17H2,(H,18,19) |
| InChIKey | VIQSKFUDEPIADL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|